C20H27Cl2N — CID 19773300
N-(4-phenylbutyl)-1,2,3,4-tetrahydronaphthalen-1-amine;dihydrochloride (PubChem CID 19773300) has the molecular formula C20H27Cl2N and a molecular weight of 352.35 g/mol. Its IUPAC name is N-(4-phenylbutyl)-1,2,3,4-tetrahydronaphthalen-1-amine;dihydrochloride.
| Compound Name | N-(4-phenylbutyl)-1,2,3,4-tetrahydronaphthalen-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 19773300 |
| Molecular Formula | C20H27Cl2N |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | N-(4-phenylbutyl)-1,2,3,4-tetrahydronaphthalen-1-amine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(CCCCNC2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C20H25N.2ClH/c1-2-9-17(10-3-1)11-6-7-16-21-20-15-8-13-18-12-4-5-14-19(18)20;;/h1-5,9-10,12,14,20-21H,6-8,11,13,15-16H2;2*1H |
| InChIKey | BNWNXDKMBGIZEF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|