C17H21NS — CID 55122196
N-(3-phenylpropyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 55122196) has the molecular formula C17H21NS and a molecular weight of 271.43 g/mol. Its IUPAC name is N-(3-phenylpropyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | N-(3-phenylpropyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 55122196 |
| Molecular Formula | C17H21NS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-(3-phenylpropyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | c1ccc(CCCNC2CCCc3sccc32)cc1 |
| InChI | InChI=1S/C17H21NS/c1-2-6-14(7-3-1)8-5-12-18-16-9-4-10-17-15(16)11-13-19-17/h1-3,6-7,11,13,16,18H,4-5,8-10,12H2 |
| InChIKey | UEGIPGVIXPPGFY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|