C13H21NOS — CID 62839954
5-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)pentan-1-ol (PubChem CID 62839954) has the molecular formula C13H21NOS and a molecular weight of 239.38 g/mol. Its IUPAC name is 5-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)pentan-1-ol.
| Compound Name | 5-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)pentan-1-ol |
|---|---|
| PubChem CID | 62839954 |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 5-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)pentan-1-ol |
| SMILES | OCCCCCNC1CCCc2sccc21 |
| InChI | InChI=1S/C13H21NOS/c15-9-3-1-2-8-14-12-5-4-6-13-11(12)7-10-16-13/h7,10,12,14-15H,1-6,8-9H2 |
| InChIKey | SXNVTWKNCFPNJC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|