C16H27N3S — CID 62840199
N-[3-(4-methylpiperazin-1-yl)propyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 62840199) has the molecular formula C16H27N3S and a molecular weight of 293.48 g/mol. Its IUPAC name is N-[3-(4-methylpiperazin-1-yl)propyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | N-[3-(4-methylpiperazin-1-yl)propyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 62840199 |
| Molecular Formula | C16H27N3S |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | N-[3-(4-methylpiperazin-1-yl)propyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | CN1CCN(CCCNC2CCCc3sccc32)CC1 |
| InChI | InChI=1S/C16H27N3S/c1-18-9-11-19(12-10-18)8-3-7-17-15-4-2-5-16-14(15)6-13-20-16/h6,13,15,17H,2-5,7-12H2,1H3 |
| InChIKey | YFJPUUGHGCBMNL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|