C16H26IN3S — CID 82687483
2-iodo-N-[3-(4-methylpiperazin-1-yl)propyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82687483) has the molecular formula C16H26IN3S and a molecular weight of 419.38 g/mol. Its IUPAC name is 2-iodo-N-[3-(4-methylpiperazin-1-yl)propyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-iodo-N-[3-(4-methylpiperazin-1-yl)propyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82687483 |
| Molecular Formula | C16H26IN3S |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 2-iodo-N-[3-(4-methylpiperazin-1-yl)propyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | CN1CCN(CCCNC2CCCc3sc(I)cc32)CC1 |
| InChI | InChI=1S/C16H26IN3S/c1-19-8-10-20(11-9-19)7-3-6-18-14-4-2-5-15-13(14)12-16(17)21-15/h12,14,18H,2-11H2,1H3 |
| InChIKey | HRQUMJPSQNWUBX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|