C13H19IN2S — CID 82690321
N-(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1-methylpyrrolidin-3-amine (PubChem CID 82690321) has the molecular formula C13H19IN2S and a molecular weight of 362.28 g/mol. Its IUPAC name is N-(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1-methylpyrrolidin-3-amine.
| Compound Name | N-(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 82690321 |
| Molecular Formula | C13H19IN2S |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | N-(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1-methylpyrrolidin-3-amine |
| SMILES | CN1CCC(NC2CCCc3sc(I)cc32)C1 |
| InChI | InChI=1S/C13H19IN2S/c1-16-6-5-9(8-16)15-11-3-2-4-12-10(11)7-13(14)17-12/h7,9,11,15H,2-6,8H2,1H3 |
| InChIKey | XBDRUSBPJVWOFN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|