C14H20INS — CID 82690638
N-(1-cyclopropylpropan-2-yl)-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82690638) has the molecular formula C14H20INS and a molecular weight of 361.29 g/mol. Its IUPAC name is N-(1-cyclopropylpropan-2-yl)-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | N-(1-cyclopropylpropan-2-yl)-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82690638 |
| Molecular Formula | C14H20INS |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | N-(1-cyclopropylpropan-2-yl)-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | CC(CC1CC1)NC1CCCc2sc(I)cc21 |
| InChI | InChI=1S/C14H20INS/c1-9(7-10-5-6-10)16-12-3-2-4-13-11(12)8-14(15)17-13/h8-10,12,16H,2-7H2,1H3 |
| InChIKey | LKQTUQGLKAFHQY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|