C10H14INS — CID 82687105
N-ethyl-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82687105) has the molecular formula C10H14INS and a molecular weight of 307.20 g/mol. Its IUPAC name is N-ethyl-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | N-ethyl-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82687105 |
| Molecular Formula | C10H14INS |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | N-ethyl-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | CCNC1CCCc2sc(I)cc21 |
| InChI | InChI=1S/C10H14INS/c1-2-12-8-4-3-5-9-7(8)6-10(11)13-9/h6,8,12H,2-5H2,1H3 |
| InChIKey | GYAWFVFTHFLPCK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|