C15H24INOS — CID 106250834
2-ethyl-2-[[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]methyl]butan-1-ol (PubChem CID 106250834) has the molecular formula C15H24INOS and a molecular weight of 393.33 g/mol. Its IUPAC name is 2-ethyl-2-[[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]methyl]butan-1-ol.
| Compound Name | 2-ethyl-2-[[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]methyl]butan-1-ol |
|---|---|
| PubChem CID | 106250834 |
| Molecular Formula | C15H24INOS |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 2-ethyl-2-[[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]methyl]butan-1-ol |
| SMILES | CCC(CC)(CO)CNC1CCCc2sc(I)cc21 |
| InChI | InChI=1S/C15H24INOS/c1-3-15(4-2,10-18)9-17-12-6-5-7-13-11(12)8-14(16)19-13/h8,12,17-18H,3-7,9-10H2,1-2H3 |
| InChIKey | MVBLOBFISYJVMG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|