C17H20INS — CID 106899394
N-[(4-ethylphenyl)methyl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 106899394) has the molecular formula C17H20INS and a molecular weight of 397.33 g/mol. Its IUPAC name is N-[(4-ethylphenyl)methyl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | N-[(4-ethylphenyl)methyl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 106899394 |
| Molecular Formula | C17H20INS |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | N-[(4-ethylphenyl)methyl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | CCc1ccc(CNC2CCCc3sc(I)cc32)cc1 |
| InChI | InChI=1S/C17H20INS/c1-2-12-6-8-13(9-7-12)11-19-15-4-3-5-16-14(15)10-17(18)20-16/h6-10,15,19H,2-5,11H2,1H3 |
| InChIKey | HGTDQSJTLJPWMN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|