C15H17IN2OS — CID 82689733
2-iodo-N-[(2-methoxy-3-pyridinyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82689733) has the molecular formula C15H17IN2OS and a molecular weight of 400.29 g/mol. Its IUPAC name is 2-iodo-N-[(2-methoxy-3-pyridinyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-iodo-N-[(2-methoxy-3-pyridinyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82689733 |
| Molecular Formula | C15H17IN2OS |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 2-iodo-N-[(2-methoxy-3-pyridinyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | COc1ncccc1CNC1CCCc2sc(I)cc21 |
| InChI | InChI=1S/C15H17IN2OS/c1-19-15-10(4-3-7-17-15)9-18-12-5-2-6-13-11(12)8-14(16)20-13/h3-4,7-8,12,18H,2,5-6,9H2,1H3 |
| InChIKey | NLJIHNLLUFDDMY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|