C17H20INOS — CID 106259645
2-iodo-N-[2-(2-methoxyphenyl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 106259645) has the molecular formula C17H20INOS and a molecular weight of 413.32 g/mol. Its IUPAC name is 2-iodo-N-[2-(2-methoxyphenyl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-iodo-N-[2-(2-methoxyphenyl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 106259645 |
| Molecular Formula | C17H20INOS |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | 2-iodo-N-[2-(2-methoxyphenyl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | COc1ccccc1CCNC1CCCc2sc(I)cc21 |
| InChI | InChI=1S/C17H20INOS/c1-20-15-7-3-2-5-12(15)9-10-19-14-6-4-8-16-13(14)11-17(18)21-16/h2-3,5,7,11,14,19H,4,6,8-10H2,1H3 |
| InChIKey | GBDGJQASEAMAGF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|