C11H17IN2O2S2 — CID 82686031
N-[2-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]ethyl]methanesulfonamide (PubChem CID 82686031) has the molecular formula C11H17IN2O2S2 and a molecular weight of 400.31 g/mol. Its IUPAC name is N-[2-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 82686031 |
| Molecular Formula | C11H17IN2O2S2 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.98 |
| IUPAC Name | N-[2-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNC1CCCc2sc(I)cc21 |
| InChI | InChI=1S/C11H17IN2O2S2/c1-18(15,16)14-6-5-13-9-3-2-4-10-8(9)7-11(12)17-10/h7,9,13-14H,2-6H2,1H3 |
| InChIKey | DHUWRILSKBAOPY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|