C13H17F3INS — CID 82695775
2-iodo-N-(5,5,5-trifluoropentyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82695775) has the molecular formula C13H17F3INS and a molecular weight of 403.25 g/mol. Its IUPAC name is 2-iodo-N-(5,5,5-trifluoropentyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-iodo-N-(5,5,5-trifluoropentyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82695775 |
| Molecular Formula | C13H17F3INS |
| Molecular Weight | 403.25 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 2-iodo-N-(5,5,5-trifluoropentyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | FC(F)(F)CCCCNC1CCCc2sc(I)cc21 |
| InChI | InChI=1S/C13H17F3INS/c14-13(15,16)6-1-2-7-18-10-4-3-5-11-9(10)8-12(17)19-11/h8,10,18H,1-7H2 |
| InChIKey | ARSAXBADVSEMSU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.25 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|