C14H14F3NS — CID 101163483
2,2,2-trifluoro-N-[(1S)-1-phenylethyl]-1-thiophen-2-ylethanamine (PubChem CID 101163483) has the molecular formula C14H14F3NS and a molecular weight of 285.33 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1S)-1-phenylethyl]-1-thiophen-2-ylethanamine.
| Compound Name | 2,2,2-trifluoro-N-[(1S)-1-phenylethyl]-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 101163483 |
| Molecular Formula | C14H14F3NS |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1S)-1-phenylethyl]-1-thiophen-2-ylethanamine |
| SMILES | C[C@H](NC(c1cccs1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H14F3NS/c1-10(11-6-3-2-4-7-11)18-13(14(15,16)17)12-8-5-9-19-12/h2-10,13,18H,1H3/t10-,13?/m0/s1 |
| InChIKey | ULVJCHHBGQMTDF-NKUHCKNESA-N |
| XLogP | 4.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |