C11H13F3INS2 — CID 114187429
2-iodo-N-[2-(trifluoromethylsulfanyl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 114187429) has the molecular formula C11H13F3INS2 and a molecular weight of 407.26 g/mol. Its IUPAC name is 2-iodo-N-[2-(trifluoromethylsulfanyl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-iodo-N-[2-(trifluoromethylsulfanyl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 114187429 |
| Molecular Formula | C11H13F3INS2 |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 406.95 |
| IUPAC Name | 2-iodo-N-[2-(trifluoromethylsulfanyl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | FC(F)(F)SCCNC1CCCc2sc(I)cc21 |
| InChI | InChI=1S/C11H13F3INS2/c12-11(13,14)17-5-4-16-8-2-1-3-9-7(8)6-10(15)18-9/h6,8,16H,1-5H2 |
| InChIKey | HRBPEMPWWAOVIO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|