C14H17FN2O2S2 — CID 71934393
N-[2-[[5-(3-fluorophenyl)thiophen-2-yl]methylamino]ethyl]methanesulfonamide (PubChem CID 71934393) has the molecular formula C14H17FN2O2S2 and a molecular weight of 328.43 g/mol. Its IUPAC name is N-[2-[[5-(3-fluorophenyl)thiophen-2-yl]methylamino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[5-(3-fluorophenyl)thiophen-2-yl]methylamino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 71934393 |
| Molecular Formula | C14H17FN2O2S2 |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | N-[2-[[5-(3-fluorophenyl)thiophen-2-yl]methylamino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNCc1ccc(-c2cccc(F)c2)s1 |
| InChI | InChI=1S/C14H17FN2O2S2/c1-21(18,19)17-8-7-16-10-13-5-6-14(20-13)11-3-2-4-12(15)9-11/h2-6,9,16-17H,7-8,10H2,1H3 |
| InChIKey | LPPVWIINDLMOSG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|