C15H16INOS — CID 114331527
2-[[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]methyl]phenol (PubChem CID 114331527) has the molecular formula C15H16INOS and a molecular weight of 385.27 g/mol. Its IUPAC name is 2-[[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]methyl]phenol.
| Compound Name | 2-[[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 114331527 |
| Molecular Formula | C15H16INOS |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | 2-[[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]methyl]phenol |
| SMILES | Oc1ccccc1CNC1CCCc2sc(I)cc21 |
| InChI | InChI=1S/C15H16INOS/c16-15-8-11-12(5-3-7-14(11)19-15)17-9-10-4-1-2-6-13(10)18/h1-2,4,6,8,12,17-18H,3,5,7,9H2 |
| InChIKey | DOGVDHIONHVLMK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|