C16H18INS2 — CID 82689738
2-iodo-N-(2-phenylsulfanylethyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82689738) has the molecular formula C16H18INS2 and a molecular weight of 415.37 g/mol. Its IUPAC name is 2-iodo-N-(2-phenylsulfanylethyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-iodo-N-(2-phenylsulfanylethyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82689738 |
| Molecular Formula | C16H18INS2 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | 2-iodo-N-(2-phenylsulfanylethyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | Ic1cc2c(s1)CCCC2NCCSc1ccccc1 |
| InChI | InChI=1S/C16H18INS2/c17-16-11-13-14(7-4-8-15(13)20-16)18-9-10-19-12-5-2-1-3-6-12/h1-3,5-6,11,14,18H,4,7-10H2 |
| InChIKey | GYLVWHFHDLDAKV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|