C11H16INOS — CID 82686530
2-iodo-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82686530) has the molecular formula C11H16INOS and a molecular weight of 337.23 g/mol. Its IUPAC name is 2-iodo-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-iodo-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82686530 |
| Molecular Formula | C11H16INOS |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 2-iodo-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | COCCNC1CCCc2sc(I)cc21 |
| InChI | InChI=1S/C11H16INOS/c1-14-6-5-13-9-3-2-4-10-8(9)7-11(12)15-10/h7,9,13H,2-6H2,1H3 |
| InChIKey | DNTFHUQMFAHHMB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|