C15H23IN2OS — CID 82689664
N-butan-2-yl-3-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]propanamide (PubChem CID 82689664) has the molecular formula C15H23IN2OS and a molecular weight of 406.33 g/mol. Its IUPAC name is N-butan-2-yl-3-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]propanamide.
| Compound Name | N-butan-2-yl-3-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 82689664 |
| Molecular Formula | C15H23IN2OS |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | N-butan-2-yl-3-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]propanamide |
| SMILES | CCC(C)NC(=O)CCNC1CCCc2sc(I)cc21 |
| InChI | InChI=1S/C15H23IN2OS/c1-3-10(2)18-15(19)7-8-17-12-5-4-6-13-11(12)9-14(16)20-13/h9-10,12,17H,3-8H2,1-2H3,(H,18,19) |
| InChIKey | ZBWUCIQMPYDTPV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|