C16H22INS — CID 82689981
N-(2-bicyclo[2.2.1]heptanylmethyl)-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82689981) has the molecular formula C16H22INS and a molecular weight of 387.33 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanylmethyl)-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82689981 |
| Molecular Formula | C16H22INS |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | Ic1cc2c(s1)CCCC2NCC1CC2CCC1C2 |
| InChI | InChI=1S/C16H22INS/c17-16-8-13-14(2-1-3-15(13)19-16)18-9-12-7-10-4-5-11(12)6-10/h8,10-12,14,18H,1-7,9H2 |
| InChIKey | IDUUQZLUEAVNSQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|