C12H13IN2S — CID 82689715
N-(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pyrrol-1-amine (PubChem CID 82689715) has the molecular formula C12H13IN2S and a molecular weight of 344.22 g/mol. Its IUPAC name is N-(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pyrrol-1-amine.
| Compound Name | N-(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pyrrol-1-amine |
|---|---|
| PubChem CID | 82689715 |
| Molecular Formula | C12H13IN2S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | N-(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pyrrol-1-amine |
| SMILES | Ic1cc2c(s1)CCCC2Nn1cccc1 |
| InChI | InChI=1S/C12H13IN2S/c13-12-8-9-10(4-3-5-11(9)16-12)14-15-6-1-2-7-15/h1-2,6-8,10,14H,3-5H2 |
| InChIKey | LODDUYCTDKGJKZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|