C17H27IN2S — CID 82012027
1-tert-butyl-N-(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)piperidin-4-amine (PubChem CID 82012027) has the molecular formula C17H27IN2S and a molecular weight of 418.39 g/mol. Its IUPAC name is 1-tert-butyl-N-(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)piperidin-4-amine.
| Compound Name | 1-tert-butyl-N-(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 82012027 |
| Molecular Formula | C17H27IN2S |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 1-tert-butyl-N-(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)piperidin-4-amine |
| SMILES | CC(C)(C)N1CCC(NC2CCCc3sc(I)cc32)CC1 |
| InChI | InChI=1S/C17H27IN2S/c1-17(2,3)20-9-7-12(8-10-20)19-14-5-4-6-15-13(14)11-16(18)21-15/h11-12,14,19H,4-10H2,1-3H3 |
| InChIKey | GLVMJKYMVKOKEF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|