C14H19IN2OS — CID 82687173
3-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]azepan-2-one (PubChem CID 82687173) has the molecular formula C14H19IN2OS and a molecular weight of 390.29 g/mol. Its IUPAC name is 3-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]azepan-2-one.
| Compound Name | 3-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]azepan-2-one |
|---|---|
| PubChem CID | 82687173 |
| Molecular Formula | C14H19IN2OS |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 3-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]azepan-2-one |
| SMILES | O=C1NCCCCC1NC1CCCc2sc(I)cc21 |
| InChI | InChI=1S/C14H19IN2OS/c15-13-8-9-10(5-3-6-12(9)19-13)17-11-4-1-2-7-16-14(11)18/h8,10-11,17H,1-7H2,(H,16,18) |
| InChIKey | SOJBDVOXKSFZQD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|