C13H15IN2O2S — CID 82689859
3-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]piperidine-2,6-dione (PubChem CID 82689859) has the molecular formula C13H15IN2O2S and a molecular weight of 390.25 g/mol. Its IUPAC name is 3-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]piperidine-2,6-dione.
| Compound Name | 3-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 82689859 |
| Molecular Formula | C13H15IN2O2S |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | 3-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]piperidine-2,6-dione |
| SMILES | O=C1CCC(NC2CCCc3sc(I)cc32)C(=O)N1 |
| InChI | InChI=1S/C13H15IN2O2S/c14-11-6-7-8(2-1-3-10(7)19-11)15-9-4-5-12(17)16-13(9)18/h6,8-9,15H,1-5H2,(H,16,17,18) |
| InChIKey | NHHUVSUCAFRROY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|