C14H13I2NS — CID 82686752
2-iodo-N-(3-iodophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82686752) has the molecular formula C14H13I2NS and a molecular weight of 481.14 g/mol. Its IUPAC name is 2-iodo-N-(3-iodophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-iodo-N-(3-iodophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82686752 |
| Molecular Formula | C14H13I2NS |
| Molecular Weight | 481.14 g/mol |
| Exact Mass | 480.89 |
| IUPAC Name | 2-iodo-N-(3-iodophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | Ic1cccc(NC2CCCc3sc(I)cc32)c1 |
| InChI | InChI=1S/C14H13I2NS/c15-9-3-1-4-10(7-9)17-12-5-2-6-13-11(12)8-14(16)18-13/h1,3-4,7-8,12,17H,2,5-6H2 |
| InChIKey | BXJAGQNEZLKSQW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.14 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|