C15H16IN3OS — CID 82012746
[3-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]phenyl]urea (PubChem CID 82012746) has the molecular formula C15H16IN3OS and a molecular weight of 413.28 g/mol. Its IUPAC name is [3-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]phenyl]urea.
| Compound Name | [3-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]phenyl]urea |
|---|---|
| PubChem CID | 82012746 |
| Molecular Formula | C15H16IN3OS |
| Molecular Weight | 413.28 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | [3-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]phenyl]urea |
| SMILES | NC(=O)Nc1cccc(NC2CCCc3sc(I)cc32)c1 |
| InChI | InChI=1S/C15H16IN3OS/c16-14-8-11-12(5-2-6-13(11)21-14)18-9-3-1-4-10(7-9)19-15(17)20/h1,3-4,7-8,12,18H,2,5-6H2,(H3,17,19,20) |
| InChIKey | NJCGMIHNQYJUIO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.28 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|