C12H12INS2 — CID 82690069
2-iodo-N-thiophen-3-yl-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82690069) has the molecular formula C12H12INS2 and a molecular weight of 361.27 g/mol. Its IUPAC name is 2-iodo-N-thiophen-3-yl-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-iodo-N-thiophen-3-yl-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82690069 |
| Molecular Formula | C12H12INS2 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 360.95 |
| IUPAC Name | 2-iodo-N-thiophen-3-yl-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | Ic1cc2c(s1)CCCC2Nc1ccsc1 |
| InChI | InChI=1S/C12H12INS2/c13-12-6-9-10(2-1-3-11(9)16-12)14-8-4-5-15-7-8/h4-7,10,14H,1-3H2 |
| InChIKey | XEZNQZWYYQUIJL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|