C16H18INOS — CID 82686767
2-iodo-N-[3-(methoxymethyl)phenyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82686767) has the molecular formula C16H18INOS and a molecular weight of 399.30 g/mol. Its IUPAC name is 2-iodo-N-[3-(methoxymethyl)phenyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-iodo-N-[3-(methoxymethyl)phenyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82686767 |
| Molecular Formula | C16H18INOS |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 2-iodo-N-[3-(methoxymethyl)phenyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | COCc1cccc(NC2CCCc3sc(I)cc32)c1 |
| InChI | InChI=1S/C16H18INOS/c1-19-10-11-4-2-5-12(8-11)18-14-6-3-7-15-13(14)9-16(17)20-15/h2,4-5,8-9,14,18H,3,6-7,10H2,1H3 |
| InChIKey | MFPMYXVMYYPFFE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|