C16H19IN2OS — CID 82012022
5-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-1-propylpyridin-2-one (PubChem CID 82012022) has the molecular formula C16H19IN2OS and a molecular weight of 414.31 g/mol. Its IUPAC name is 5-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-1-propylpyridin-2-one.
| Compound Name | 5-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-1-propylpyridin-2-one |
|---|---|
| PubChem CID | 82012022 |
| Molecular Formula | C16H19IN2OS |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 5-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-1-propylpyridin-2-one |
| SMILES | CCCn1cc(NC2CCCc3sc(I)cc32)ccc1=O |
| InChI | InChI=1S/C16H19IN2OS/c1-2-8-19-10-11(6-7-16(19)20)18-13-4-3-5-14-12(13)9-15(17)21-14/h6-7,9-10,13,18H,2-5,8H2,1H3 |
| InChIKey | ZVKRXJHOKNIAQC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|