C13H20N2O3S — CID 54863769
5-[(1,1-dioxothian-4-yl)amino]-1-propylpyridin-2-one (PubChem CID 54863769) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is 5-[(1,1-dioxothian-4-yl)amino]-1-propylpyridin-2-one.
| Compound Name | 5-[(1,1-dioxothian-4-yl)amino]-1-propylpyridin-2-one |
|---|---|
| PubChem CID | 54863769 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 5-[(1,1-dioxothian-4-yl)amino]-1-propylpyridin-2-one |
| SMILES | CCCn1cc(NC2CCS(=O)(=O)CC2)ccc1=O |
| InChI | InChI=1S/C13H20N2O3S/c1-2-7-15-10-12(3-4-13(15)16)14-11-5-8-19(17,18)9-6-11/h3-4,10-11,14H,2,5-9H2,1H3 |
| InChIKey | ZLVIICRDQZZFPO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |