About N-(4-ethylphenyl)-1,1-dioxothian-4-amine
N-(4-ethylphenyl)-1,1-dioxothian-4-amine (PubChem CID 43511548) has the molecular formula C13H19NO2S
and a molecular weight of 253.37 g/mol. Its IUPAC name is N-(4-ethylphenyl)-1,1-dioxothian-4-amine.
Molecular Properties
| Compound Name | N-(4-ethylphenyl)-1,1-dioxothian-4-amine |
| PubChem CID | 43511548 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-(4-ethylphenyl)-1,1-dioxothian-4-amine |
| SMILES | CCc1ccc(NC2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C13H19NO2S/c1-2-11-3-5-12(6-4-11)14-13-7-9-17(15,16)10-8-13/h3-6,13-14H,2,7-10H2,1H3 |
| InChIKey | AQVDGADMEOIMGX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-ethylphenyl)-1,1-dioxothian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-ethylphenyl)-1,1-dioxothian-4-amine?
The IUPAC name of N-(4-ethylphenyl)-1,1-dioxothian-4-amine (CID 43511548) is N-(4-ethylphenyl)-1,1-dioxothian-4-amine.
What is the SMILES notation for N-(4-ethylphenyl)-1,1-dioxothian-4-amine?
The canonical SMILES for N-(4-ethylphenyl)-1,1-dioxothian-4-amine is CCc1ccc(NC2CCS(=O)(=O)CC2)cc1.
What is the InChIKey of N-(4-ethylphenyl)-1,1-dioxothian-4-amine?
The InChIKey is AQVDGADMEOIMGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2S/c1-2-11-3-5-12(6-4-11)14-13-7-9-17(15,16)10-8-13/h3-6,13-14H,2,7-10H2,1H3.
What are the key properties of N-(4-ethylphenyl)-1,1-dioxothian-4-amine?
N-(4-ethylphenyl)-1,1-dioxothian-4-amine has a molecular weight of 253.37 g/mol, XLogP of 2.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-ethylphenyl)-1,1-dioxothian-4-amine is sourced from PubChem (CID 43511548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).