C13H19NO2S — CID 43511548
N-(4-ethylphenyl)-1,1-dioxothian-4-amine (PubChem CID 43511548) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is N-(4-ethylphenyl)-1,1-dioxothian-4-amine.
| Compound Name | N-(4-ethylphenyl)-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 43511548 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-(4-ethylphenyl)-1,1-dioxothian-4-amine |
| SMILES | CCc1ccc(NC2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C13H19NO2S/c1-2-11-3-5-12(6-4-11)14-13-7-9-17(15,16)10-8-13/h3-6,13-14H,2,7-10H2,1H3 |
| InChIKey | AQVDGADMEOIMGX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |