C11H12F4INS — CID 114168997
2-iodo-N-(2,2,3,3-tetrafluoropropyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 114168997) has the molecular formula C11H12F4INS and a molecular weight of 393.19 g/mol. Its IUPAC name is 2-iodo-N-(2,2,3,3-tetrafluoropropyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-iodo-N-(2,2,3,3-tetrafluoropropyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 114168997 |
| Molecular Formula | C11H12F4INS |
| Molecular Weight | 393.19 g/mol |
| Exact Mass | 392.97 |
| IUPAC Name | 2-iodo-N-(2,2,3,3-tetrafluoropropyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | FC(F)C(F)(F)CNC1CCCc2sc(I)cc21 |
| InChI | InChI=1S/C11H12F4INS/c12-10(13)11(14,15)5-17-7-2-1-3-8-6(7)4-9(16)18-8/h4,7,10,17H,1-3,5H2 |
| InChIKey | GQXVINVQVBSYCX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.19 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|