C13H20INOS — CID 82689643
(2S)-2-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-3-methylbutan-1-ol (PubChem CID 82689643) has the molecular formula C13H20INOS and a molecular weight of 365.28 g/mol. Its IUPAC name is (2S)-2-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-3-methylbutan-1-ol.
| Compound Name | (2S)-2-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 82689643 |
| Molecular Formula | C13H20INOS |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | (2S)-2-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-3-methylbutan-1-ol |
| SMILES | CC(C)[C@@H](CO)NC1CCCc2sc(I)cc21 |
| InChI | InChI=1S/C13H20INOS/c1-8(2)11(7-16)15-10-4-3-5-12-9(10)6-13(14)17-12/h6,8,10-11,15-16H,3-5,7H2,1-2H3/t10?,11-/m1/s1 |
| InChIKey | CAXZQXCZVKJNSH-RRKGBCIJSA-N |
| XLogP | 3.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|