C13H16IN3S — CID 106209184
2-iodo-N-[1-(1H-pyrazol-4-yl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 106209184) has the molecular formula C13H16IN3S and a molecular weight of 373.26 g/mol. Its IUPAC name is 2-iodo-N-[1-(1H-pyrazol-4-yl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-iodo-N-[1-(1H-pyrazol-4-yl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 106209184 |
| Molecular Formula | C13H16IN3S |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | 2-iodo-N-[1-(1H-pyrazol-4-yl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | CC(NC1CCCc2sc(I)cc21)c1cn[nH]c1 |
| InChI | InChI=1S/C13H16IN3S/c1-8(9-6-15-16-7-9)17-11-3-2-4-12-10(11)5-13(14)18-12/h5-8,11,17H,2-4H2,1H3,(H,15,16) |
| InChIKey | QJBSCFYVVGSDFY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|