C14H16INOS — CID 82695600
N-[(1R)-1-(furan-2-yl)ethyl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82695600) has the molecular formula C14H16INOS and a molecular weight of 373.26 g/mol. Its IUPAC name is N-[(1R)-1-(furan-2-yl)ethyl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | N-[(1R)-1-(furan-2-yl)ethyl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82695600 |
| Molecular Formula | C14H16INOS |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | N-[(1R)-1-(furan-2-yl)ethyl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | C[C@@H](NC1CCCc2sc(I)cc21)c1ccco1 |
| InChI | InChI=1S/C14H16INOS/c1-9(12-5-3-7-17-12)16-11-4-2-6-13-10(11)8-14(15)18-13/h3,5,7-9,11,16H,2,4,6H2,1H3/t9-,11?/m1/s1 |
| InChIKey | YIHSEMPDYITCJI-BFHBGLAWSA-N |
| XLogP | 4.67 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|