C15H18INOS — CID 82687266
N-[1-(furan-2-yl)propan-2-yl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82687266) has the molecular formula C15H18INOS and a molecular weight of 387.29 g/mol. Its IUPAC name is N-[1-(furan-2-yl)propan-2-yl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | N-[1-(furan-2-yl)propan-2-yl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82687266 |
| Molecular Formula | C15H18INOS |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | N-[1-(furan-2-yl)propan-2-yl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | CC(Cc1ccco1)NC1CCCc2sc(I)cc21 |
| InChI | InChI=1S/C15H18INOS/c1-10(8-11-4-3-7-18-11)17-13-5-2-6-14-12(13)9-15(16)19-14/h3-4,7,9-10,13,17H,2,5-6,8H2,1H3 |
| InChIKey | BFVPYKRTTTURAV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|