C15H17IN2S — CID 82696628
2-iodo-N-[(1R)-1-pyridin-3-ylethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82696628) has the molecular formula C15H17IN2S and a molecular weight of 384.29 g/mol. Its IUPAC name is 2-iodo-N-[(1R)-1-pyridin-3-ylethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-iodo-N-[(1R)-1-pyridin-3-ylethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82696628 |
| Molecular Formula | C15H17IN2S |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 2-iodo-N-[(1R)-1-pyridin-3-ylethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | C[C@@H](NC1CCCc2sc(I)cc21)c1cccnc1 |
| InChI | InChI=1S/C15H17IN2S/c1-10(11-4-3-7-17-9-11)18-13-5-2-6-14-12(13)8-15(16)19-14/h3-4,7-10,13,18H,2,5-6H2,1H3/t10-,13?/m1/s1 |
| InChIKey | MEXHJORIIFOCJH-VUUHIHSGSA-N |
| XLogP | 4.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|