C14H20INO2S — CID 82687058
methyl (2S)-2-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-3-methylbutanoate (PubChem CID 82687058) has the molecular formula C14H20INO2S and a molecular weight of 393.29 g/mol. Its IUPAC name is methyl (2S)-2-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 82687058 |
| Molecular Formula | C14H20INO2S |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | methyl (2S)-2-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC1CCCc2sc(I)cc21)C(C)C |
| InChI | InChI=1S/C14H20INO2S/c1-8(2)13(14(17)18-3)16-10-5-4-6-11-9(10)7-12(15)19-11/h7-8,10,13,16H,4-6H2,1-3H3/t10?,13-/m0/s1 |
| InChIKey | YOPRPLJSXAFBHB-HQVZTVAUSA-N |
| XLogP | 3.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|