C11H18N2S — CID 62842141
N'-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)propane-1,3-diamine (PubChem CID 62842141) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is N'-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)propane-1,3-diamine.
| Compound Name | N'-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 62842141 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N'-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)propane-1,3-diamine |
| SMILES | NCCCNC1CCCc2sccc21 |
| InChI | InChI=1S/C11H18N2S/c12-6-2-7-13-10-3-1-4-11-9(10)5-8-14-11/h5,8,10,13H,1-4,6-7,12H2 |
| InChIKey | NYBHLCIENHYMCQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|