C18H24N4 — CID 136737906
(1R)-N-[[(6S)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 136737906) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is (1R)-N-[[(6S)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1R)-N-[[(6S)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 136737906 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (1R)-N-[[(6S)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | Cc1cc2n(n1)C[C@@H](CN[C@@H]1CCCc3ccccc31)CN2 |
| InChI | InChI=1S/C18H24N4/c1-13-9-18-20-11-14(12-22(18)21-13)10-19-17-8-4-6-15-5-2-3-7-16(15)17/h2-3,5,7,9,14,17,19-20H,4,6,8,10-12H2,1H3/t14-,17+/m0/s1 |
| InChIKey | ACWZHVJHFOWKIF-WMLDXEAASA-N |
| XLogP | 2.90 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |