C15H22N6 — CID 136905513
(4S)-1-methyl-N-[[(6S)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]-4,5,6,7-tetrahydroindazol-4-amine (PubChem CID 136905513) has the molecular formula C15H22N6 and a molecular weight of 286.38 g/mol. Its IUPAC name is (4S)-1-methyl-N-[[(6S)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]-4,5,6,7-tetrahydroindazol-4-amine.
| Compound Name | (4S)-1-methyl-N-[[(6S)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]-4,5,6,7-tetrahydroindazol-4-amine |
|---|---|
| PubChem CID | 136905513 |
| Molecular Formula | C15H22N6 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (4S)-1-methyl-N-[[(6S)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]-4,5,6,7-tetrahydroindazol-4-amine |
| SMILES | Cn1ncc2c1CCC[C@@H]2NC[C@H]1CNc2ccnn2C1 |
| InChI | InChI=1S/C15H22N6/c1-20-14-4-2-3-13(12(14)9-19-20)16-7-11-8-17-15-5-6-18-21(15)10-11/h5-6,9,11,13,16-17H,2-4,7-8,10H2,1H3/t11-,13-/m0/s1 |
| InChIKey | BBKJOXSGDDPJSX-AAEUAGOBSA-N |
| XLogP | 1.33 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |