C16H24N6 — CID 136905220
(4S)-1-methyl-N-[[(6R)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]-4,5,6,7-tetrahydroindazol-4-amine (PubChem CID 136905220) has the molecular formula C16H24N6 and a molecular weight of 300.41 g/mol. Its IUPAC name is (4S)-1-methyl-N-[[(6R)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]-4,5,6,7-tetrahydroindazol-4-amine.
| Compound Name | (4S)-1-methyl-N-[[(6R)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]-4,5,6,7-tetrahydroindazol-4-amine |
|---|---|
| PubChem CID | 136905220 |
| Molecular Formula | C16H24N6 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (4S)-1-methyl-N-[[(6R)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]-4,5,6,7-tetrahydroindazol-4-amine |
| SMILES | Cc1cc2n(n1)C[C@H](CN[C@H]1CCCc3c1cnn3C)CN2 |
| InChI | InChI=1S/C16H24N6/c1-11-6-16-18-8-12(10-22(16)20-11)7-17-14-4-3-5-15-13(14)9-19-21(15)2/h6,9,12,14,17-18H,3-5,7-8,10H2,1-2H3/t12-,14+/m1/s1 |
| InChIKey | OGIHBBCRHLBZBG-OCCSQVGLSA-N |
| XLogP | 1.63 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |