C18H33N3 — CID 115572685
2-tert-butyl-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]cyclohexan-1-amine (PubChem CID 115572685) has the molecular formula C18H33N3 and a molecular weight of 291.48 g/mol. Its IUPAC name is 2-tert-butyl-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]cyclohexan-1-amine.
| Compound Name | 2-tert-butyl-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 115572685 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | 2-tert-butyl-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]cyclohexan-1-amine |
| SMILES | Cc1cc(C)n(CCCNC2CCCCC2C(C)(C)C)n1 |
| InChI | InChI=1S/C18H33N3/c1-14-13-15(2)21(20-14)12-8-11-19-17-10-7-6-9-16(17)18(3,4)5/h13,16-17,19H,6-12H2,1-5H3 |
| InChIKey | FYRMSAJMUGTEHV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|