C15H18N2O3S2 — CID 125432180
(3S)-N-[(3S)-1,1-dioxothiolan-3-yl]-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide (PubChem CID 125432180) has the molecular formula C15H18N2O3S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is (3S)-N-[(3S)-1,1-dioxothiolan-3-yl]-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide.
| Compound Name | (3S)-N-[(3S)-1,1-dioxothiolan-3-yl]-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 125432180 |
| Molecular Formula | C15H18N2O3S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | (3S)-N-[(3S)-1,1-dioxothiolan-3-yl]-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide |
| SMILES | O=C(C[C@@H](c1ccsc1)n1cccc1)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18N2O3S2/c18-15(16-13-4-8-22(19,20)11-13)9-14(12-3-7-21-10-12)17-5-1-2-6-17/h1-3,5-7,10,13-14H,4,8-9,11H2,(H,16,18)/t13-,14-/m0/s1 |
| InChIKey | XZUZDHXXDRKOIK-KBPBESRZSA-N |
| XLogP | 1.83 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |