C22H26N4OS — CID 128963508
N-[4-(4-methylpiperazin-1-yl)phenyl]-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide (PubChem CID 128963508) has the molecular formula C22H26N4OS and a molecular weight of 394.54 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 128963508 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide |
| SMILES | CN1CCN(c2ccc(NC(=O)CC(c3ccsc3)n3cccc3)cc2)CC1 |
| InChI | InChI=1S/C22H26N4OS/c1-24-11-13-25(14-12-24)20-6-4-19(5-7-20)23-22(27)16-21(18-8-15-28-17-18)26-9-2-3-10-26/h2-10,15,17,21H,11-14,16H2,1H3,(H,23,27) |
| InChIKey | BBMSTHLWWNULAO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|