C19H16N4O3S — CID 125434027
(3R)-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide (PubChem CID 125434027) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is (3R)-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide.
| Compound Name | (3R)-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 125434027 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (3R)-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-3-pyrrol-1-yl-3-thiophen-3-ylpropanamide |
| SMILES | O=C(C[C@H](c1ccsc1)n1cccc1)Nc1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C19H16N4O3S/c24-17(10-16(12-5-8-27-11-12)23-6-1-2-7-23)20-13-3-4-14-15(9-13)22-19(26)18(25)21-14/h1-9,11,16H,10H2,(H,20,24)(H,21,25)(H,22,26)/t16-/m1/s1 |
| InChIKey | FYISQCJWSCSVQA-MRXNPFEDSA-N |
| XLogP | 2.70 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|