C12H14N4O3 — CID 60836174
3-amino-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)butanamide (PubChem CID 60836174) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 3-amino-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)butanamide.
| Compound Name | 3-amino-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)butanamide |
|---|---|
| PubChem CID | 60836174 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 3-amino-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)butanamide |
| SMILES | CC(N)CC(=O)Nc1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C12H14N4O3/c1-6(13)4-10(17)14-7-2-3-8-9(5-7)16-12(19)11(18)15-8/h2-3,5-6H,4,13H2,1H3,(H,14,17)(H,15,18)(H,16,19) |
| InChIKey | UTFYXRRXDVYKOL-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|