C13H14BrN3O3 — CID 107908877
5-bromo-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)pentanamide (PubChem CID 107908877) has the molecular formula C13H14BrN3O3 and a molecular weight of 340.18 g/mol. Its IUPAC name is 5-bromo-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)pentanamide.
| Compound Name | 5-bromo-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)pentanamide |
|---|---|
| PubChem CID | 107908877 |
| Molecular Formula | C13H14BrN3O3 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 5-bromo-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)pentanamide |
| SMILES | O=C(CCCCBr)Nc1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C13H14BrN3O3/c14-6-2-1-3-11(18)15-8-4-5-9-10(7-8)17-13(20)12(19)16-9/h4-5,7H,1-3,6H2,(H,15,18)(H,16,19)(H,17,20) |
| InChIKey | HWBTXYQRSIYJPW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|